C17H15Cl3N6O — CID 85331489
3-chloro-N-[2,2-dichloro-1-[[(cyanoamino)-(pyridin-3-ylamino)methylidene]amino]propyl]benzamide (PubChem CID 85331489) has the molecular formula C17H15Cl3N6O and a molecular weight of 425.71 g/mol. Its IUPAC name is 3-chloro-N-[2,2-dichloro-1-[[(cyanoamino)-(pyridin-3-ylamino)methylidene]amino]propyl]benzamide.
| Compound Name | 3-chloro-N-[2,2-dichloro-1-[[(cyanoamino)-(pyridin-3-ylamino)methylidene]amino]propyl]benzamide |
|---|---|
| PubChem CID | 85331489 |
| Molecular Formula | C17H15Cl3N6O |
| Molecular Weight | 425.71 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | 3-chloro-N-[2,2-dichloro-1-[[(cyanoamino)-(pyridin-3-ylamino)methylidene]amino]propyl]benzamide |
| SMILES | CC(Cl)(Cl)C(N=C(NC#N)Nc1cccnc1)NC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H15Cl3N6O/c1-17(19,20)15(25-14(27)11-4-2-5-12(18)8-11)26-16(23-10-21)24-13-6-3-7-22-9-13/h2-9,15H,1H3,(H,25,27)(H2,23,24,26) |
| InChIKey | ZRYMZYJAOOWFPI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.71 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|