C19H21BrN6O — CID 91376987
4-bromo-N-[1-[[(cyanoamino)-(pyridin-3-ylamino)methylidene]amino]-2,2-dimethylpropyl]benzamide (PubChem CID 91376987) has the molecular formula C19H21BrN6O and a molecular weight of 429.32 g/mol. Its IUPAC name is 4-bromo-N-[1-[[(cyanoamino)-(pyridin-3-ylamino)methylidene]amino]-2,2-dimethylpropyl]benzamide.
| Compound Name | 4-bromo-N-[1-[[(cyanoamino)-(pyridin-3-ylamino)methylidene]amino]-2,2-dimethylpropyl]benzamide |
|---|---|
| PubChem CID | 91376987 |
| Molecular Formula | C19H21BrN6O |
| Molecular Weight | 429.32 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | 4-bromo-N-[1-[[(cyanoamino)-(pyridin-3-ylamino)methylidene]amino]-2,2-dimethylpropyl]benzamide |
| SMILES | CC(C)(C)C(N=C(NC#N)Nc1cccnc1)NC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H21BrN6O/c1-19(2,3)17(25-16(27)13-6-8-14(20)9-7-13)26-18(23-12-21)24-15-5-4-10-22-11-15/h4-11,17H,1-3H3,(H,25,27)(H2,23,24,26) |
| InChIKey | LVJDXPNOIXPZST-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.32 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|