C19H19ClN6O — CID 87796974
4-chloro-N-[1-[(Z)-[(cyanoamino)-(pyridin-3-ylamino)methylidene]amino]cyclopentyl]benzamide (PubChem CID 87796974) has the molecular formula C19H19ClN6O and a molecular weight of 382.86 g/mol. Its IUPAC name is 4-chloro-N-[1-[(Z)-[(cyanoamino)-(pyridin-3-ylamino)methylidene]amino]cyclopentyl]benzamide.
| Compound Name | 4-chloro-N-[1-[(Z)-[(cyanoamino)-(pyridin-3-ylamino)methylidene]amino]cyclopentyl]benzamide |
|---|---|
| PubChem CID | 87796974 |
| Molecular Formula | C19H19ClN6O |
| Molecular Weight | 382.86 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 4-chloro-N-[1-[(Z)-[(cyanoamino)-(pyridin-3-ylamino)methylidene]amino]cyclopentyl]benzamide |
| SMILES | N#CN/C(=N\C1(NC(=O)c2ccc(Cl)cc2)CCCC1)Nc1cccnc1 |
| InChI | InChI=1S/C19H19ClN6O/c20-15-7-5-14(6-8-15)17(27)25-19(9-1-2-10-19)26-18(23-13-21)24-16-4-3-11-22-12-16/h3-8,11-12H,1-2,9-10H2,(H,25,27)(H2,23,24,26) |
| InChIKey | NKIDUPWYKVDGKD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.86 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|