C21H23ClN6O — CID 173218707
4-chloro-N-[5-[[(cyanoamino)-(pyridin-3-ylamino)methylidene]amino]-2,2-dimethylpent-4-enyl]benzamide (PubChem CID 173218707) has the molecular formula C21H23ClN6O and a molecular weight of 410.91 g/mol. Its IUPAC name is 4-chloro-N-[5-[[(cyanoamino)-(pyridin-3-ylamino)methylidene]amino]-2,2-dimethylpent-4-enyl]benzamide.
| Compound Name | 4-chloro-N-[5-[[(cyanoamino)-(pyridin-3-ylamino)methylidene]amino]-2,2-dimethylpent-4-enyl]benzamide |
|---|---|
| PubChem CID | 173218707 |
| Molecular Formula | C21H23ClN6O |
| Molecular Weight | 410.91 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 4-chloro-N-[5-[[(cyanoamino)-(pyridin-3-ylamino)methylidene]amino]-2,2-dimethylpent-4-enyl]benzamide |
| SMILES | CC(C)(CC=C/N=C(\NC#N)Nc1cccnc1)CNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H23ClN6O/c1-21(2,14-26-19(29)16-6-8-17(22)9-7-16)10-4-12-25-20(27-15-23)28-18-5-3-11-24-13-18/h3-9,11-13H,10,14H2,1-2H3,(H,26,29)(H2,25,27,28) |
| InChIKey | MOOHYRWOTCBYOJ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.91 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|