C24H26N6O3 — CID 173218723
N-[2,2-dimethyl-3-[(N'-nitro-N-pyridin-3-ylcarbamimidoyl)amino]propyl]-4-phenylbenzamide (PubChem CID 173218723) has the molecular formula C24H26N6O3 and a molecular weight of 446.51 g/mol. Its IUPAC name is N-[2,2-dimethyl-3-[(N'-nitro-N-pyridin-3-ylcarbamimidoyl)amino]propyl]-4-phenylbenzamide.
| Compound Name | N-[2,2-dimethyl-3-[(N'-nitro-N-pyridin-3-ylcarbamimidoyl)amino]propyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 173218723 |
| Molecular Formula | C24H26N6O3 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | N-[2,2-dimethyl-3-[(N'-nitro-N-pyridin-3-ylcarbamimidoyl)amino]propyl]-4-phenylbenzamide |
| SMILES | CC(C)(CNC(=O)c1ccc(-c2ccccc2)cc1)CNC(=N[N+](=O)[O-])Nc1cccnc1 |
| InChI | InChI=1S/C24H26N6O3/c1-24(2,17-27-23(29-30(32)33)28-21-9-6-14-25-15-21)16-26-22(31)20-12-10-19(11-13-20)18-7-4-3-5-8-18/h3-15H,16-17H2,1-2H3,(H,26,31)(H2,27,28,29) |
| InChIKey | ZYVJVNSASSAMPA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 121.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|