C24H26N6O3 — CID 173219509
N-[4-amino-3,3-dimethyl-1-nitroimino-1-(pyridin-3-ylamino)butan-2-yl]-4-phenylbenzamide (PubChem CID 173219509) has the molecular formula C24H26N6O3 and a molecular weight of 446.51 g/mol. Its IUPAC name is N-[4-amino-3,3-dimethyl-1-nitroimino-1-(pyridin-3-ylamino)butan-2-yl]-4-phenylbenzamide.
| Compound Name | N-[4-amino-3,3-dimethyl-1-nitroimino-1-(pyridin-3-ylamino)butan-2-yl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 173219509 |
| Molecular Formula | C24H26N6O3 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | N-[4-amino-3,3-dimethyl-1-nitroimino-1-(pyridin-3-ylamino)butan-2-yl]-4-phenylbenzamide |
| SMILES | CC(C)(CN)C(NC(=O)c1ccc(-c2ccccc2)cc1)C(=N[N+](=O)[O-])Nc1cccnc1 |
| InChI | InChI=1S/C24H26N6O3/c1-24(2,16-25)21(22(29-30(32)33)27-20-9-6-14-26-15-20)28-23(31)19-12-10-18(11-13-19)17-7-4-3-5-8-17/h3-15,21H,16,25H2,1-2H3,(H,27,29)(H,28,31) |
| InChIKey | YYHRBPPFTCVCHN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 135.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|