C25H29ClN6O3 — CID 135528471
N-[2-(1-adamantyl)-1-[[(E)-N'-nitro-N-pyridin-3-ylcarbamimidoyl]amino]ethyl]-4-chlorobenzamide (PubChem CID 135528471) has the molecular formula C25H29ClN6O3 and a molecular weight of 497.00 g/mol. Its IUPAC name is N-[2-(1-adamantyl)-1-[[(E)-N'-nitro-N-pyridin-3-ylcarbamimidoyl]amino]ethyl]-4-chlorobenzamide.
| Compound Name | N-[2-(1-adamantyl)-1-[[(E)-N'-nitro-N-pyridin-3-ylcarbamimidoyl]amino]ethyl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 135528471 |
| Molecular Formula | C25H29ClN6O3 |
| Molecular Weight | 497.00 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | N-[2-(1-adamantyl)-1-[[(E)-N'-nitro-N-pyridin-3-ylcarbamimidoyl]amino]ethyl]-4-chlorobenzamide |
| SMILES | O=C(NC(CC12CC3CC(CC(C3)C1)C2)N/C(=N/[N+](=O)[O-])Nc1cccnc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H29ClN6O3/c26-20-5-3-19(4-6-20)23(33)29-22(14-25-11-16-8-17(12-25)10-18(9-16)13-25)30-24(31-32(34)35)28-21-2-1-7-27-15-21/h1-7,15-18,22H,8-14H2,(H,29,33)(H2,28,30,31) |
| InChIKey | VWDFAVQIGJBWIY-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 121.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.00 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|