C25H28ClN5O3S — CID 10186036
N-[1-[(Z)-[benzenesulfonamido-(pyridin-3-ylamino)methylidene]amino]-3,3-dimethylbutyl]-4-chlorobenzamide (PubChem CID 10186036) has the molecular formula C25H28ClN5O3S and a molecular weight of 514.05 g/mol. Its IUPAC name is N-[1-[(Z)-[benzenesulfonamido-(pyridin-3-ylamino)methylidene]amino]-3,3-dimethylbutyl]-4-chlorobenzamide.
| Compound Name | N-[1-[(Z)-[benzenesulfonamido-(pyridin-3-ylamino)methylidene]amino]-3,3-dimethylbutyl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 10186036 |
| Molecular Formula | C25H28ClN5O3S |
| Molecular Weight | 514.05 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | N-[1-[(Z)-[benzenesulfonamido-(pyridin-3-ylamino)methylidene]amino]-3,3-dimethylbutyl]-4-chlorobenzamide |
| SMILES | CC(C)(C)CC(/N=C(/Nc1cccnc1)NS(=O)(=O)c1ccccc1)NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H28ClN5O3S/c1-25(2,3)16-22(29-23(32)18-11-13-19(26)14-12-18)30-24(28-20-8-7-15-27-17-20)31-35(33,34)21-9-5-4-6-10-21/h4-15,17,22H,16H2,1-3H3,(H,29,32)(H2,28,30,31) |
| InChIKey | DNZQSQHQZZONPD-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.05 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|