C20H23BrF3N5O3S — CID 18770744
4-bromo-N-[3,3-dimethyl-1-[(E)-[(pyridin-3-ylamino)-(trifluoromethylsulfonylamino)methylidene]amino]butyl]benzamide (PubChem CID 18770744) has the molecular formula C20H23BrF3N5O3S and a molecular weight of 550.40 g/mol. Its IUPAC name is 4-bromo-N-[3,3-dimethyl-1-[(E)-[(pyridin-3-ylamino)-(trifluoromethylsulfonylamino)methylidene]amino]butyl]benzamide.
| Compound Name | 4-bromo-N-[3,3-dimethyl-1-[(E)-[(pyridin-3-ylamino)-(trifluoromethylsulfonylamino)methylidene]amino]butyl]benzamide |
|---|---|
| PubChem CID | 18770744 |
| Molecular Formula | C20H23BrF3N5O3S |
| Molecular Weight | 550.40 g/mol |
| Exact Mass | 549.07 |
| IUPAC Name | 4-bromo-N-[3,3-dimethyl-1-[(E)-[(pyridin-3-ylamino)-(trifluoromethylsulfonylamino)methylidene]amino]butyl]benzamide |
| SMILES | CC(C)(C)CC(/N=C(\Nc1cccnc1)NS(=O)(=O)C(F)(F)F)NC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H23BrF3N5O3S/c1-19(2,3)11-16(27-17(30)13-6-8-14(21)9-7-13)28-18(26-15-5-4-10-25-12-15)29-33(31,32)20(22,23)24/h4-10,12,16H,11H2,1-3H3,(H,27,30)(H2,26,28,29) |
| InChIKey | BLJZKPUAQSXROJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|