C16H17Cl3N3O+ — CID 4751356
pyridin-3-ylmethyl-[2,2,2-trichloro-1-[(4-methylbenzoyl)amino]ethyl]azanium (PubChem CID 4751356) has the molecular formula C16H17Cl3N3O+ and a molecular weight of 373.69 g/mol. Its IUPAC name is pyridin-3-ylmethyl-[2,2,2-trichloro-1-[(4-methylbenzoyl)amino]ethyl]azanium.
| Compound Name | pyridin-3-ylmethyl-[2,2,2-trichloro-1-[(4-methylbenzoyl)amino]ethyl]azanium |
|---|---|
| PubChem CID | 4751356 |
| Molecular Formula | C16H17Cl3N3O+ |
| Molecular Weight | 373.69 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | pyridin-3-ylmethyl-[2,2,2-trichloro-1-[(4-methylbenzoyl)amino]ethyl]azanium |
| SMILES | Cc1ccc(C(=O)NC([NH2+]Cc2cccnc2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C16H16Cl3N3O/c1-11-4-6-13(7-5-11)14(23)22-15(16(17,18)19)21-10-12-3-2-8-20-9-12/h2-9,15,21H,10H2,1H3,(H,22,23)/p+1 |
| InChIKey | JWGOOTBOPKMPTK-UHFFFAOYSA-O |
| XLogP | 2.58 |
| TPSA | 58.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.69 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|