C17H18N2O3 — CID 7308029
(2S)-4-(4-methylphenyl)-4-oxo-2-(pyridin-3-ylmethylazaniumyl)butanoate (PubChem CID 7308029) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is (2S)-4-(4-methylphenyl)-4-oxo-2-(pyridin-3-ylmethylazaniumyl)butanoate.
| Compound Name | (2S)-4-(4-methylphenyl)-4-oxo-2-(pyridin-3-ylmethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 7308029 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | (2S)-4-(4-methylphenyl)-4-oxo-2-(pyridin-3-ylmethylazaniumyl)butanoate |
| SMILES | Cc1ccc(C(=O)C[C@H]([NH2+]Cc2cccnc2)C(=O)[O-])cc1 |
| InChI | InChI=1S/C17H18N2O3/c1-12-4-6-14(7-5-12)16(20)9-15(17(21)22)19-11-13-3-2-8-18-10-13/h2-8,10,15,19H,9,11H2,1H3,(H,21,22)/t15-/m0/s1 |
| InChIKey | AULIMKFLATWWGW-HNNXBMFYSA-N |
| XLogP | -0.16 |
| TPSA | 86.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |