C11H14Cl3N2O+ — CID 7452073
methyl-[(1S)-2,2,2-trichloro-1-[(4-methylbenzoyl)amino]ethyl]azanium (PubChem CID 7452073) has the molecular formula C11H14Cl3N2O+ and a molecular weight of 296.61 g/mol. Its IUPAC name is methyl-[(1S)-2,2,2-trichloro-1-[(4-methylbenzoyl)amino]ethyl]azanium.
| Compound Name | methyl-[(1S)-2,2,2-trichloro-1-[(4-methylbenzoyl)amino]ethyl]azanium |
|---|---|
| PubChem CID | 7452073 |
| Molecular Formula | C11H14Cl3N2O+ |
| Molecular Weight | 296.61 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | methyl-[(1S)-2,2,2-trichloro-1-[(4-methylbenzoyl)amino]ethyl]azanium |
| SMILES | C[NH2+][C@H](NC(=O)c1ccc(C)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H13Cl3N2O/c1-7-3-5-8(6-4-7)9(17)16-10(15-2)11(12,13)14/h3-6,10,15H,1-2H3,(H,16,17)/p+1/t10-/m1/s1 |
| InChIKey | MQCXGMPKZOZXRL-SNVBAGLBSA-O |
| XLogP | 1.61 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.61 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|