C12H15Cl3NO4P — CID 7032006
4-methyl-N-[(1R)-2,2,2-trichloro-1-dimethoxyphosphorylethyl]benzamide (PubChem CID 7032006) has the molecular formula C12H15Cl3NO4P and a molecular weight of 374.59 g/mol. Its IUPAC name is 4-methyl-N-[(1R)-2,2,2-trichloro-1-dimethoxyphosphorylethyl]benzamide.
| Compound Name | 4-methyl-N-[(1R)-2,2,2-trichloro-1-dimethoxyphosphorylethyl]benzamide |
|---|---|
| PubChem CID | 7032006 |
| Molecular Formula | C12H15Cl3NO4P |
| Molecular Weight | 374.59 g/mol |
| Exact Mass | 372.98 |
| IUPAC Name | 4-methyl-N-[(1R)-2,2,2-trichloro-1-dimethoxyphosphorylethyl]benzamide |
| SMILES | COP(=O)(OC)[C@@H](NC(=O)c1ccc(C)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H15Cl3NO4P/c1-8-4-6-9(7-5-8)10(17)16-11(12(13,14)15)21(18,19-2)20-3/h4-7,11H,1-3H3,(H,16,17)/t11-/m1/s1 |
| InChIKey | MUMOZFQUBDLAMR-LLVKDONJSA-N |
| XLogP | 3.91 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.59 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|