C13H15Cl3NO4P — CID 21177407
(Z)-3-phenyl-N-(2,2,2-trichloro-1-dimethoxyphosphorylethyl)prop-2-enamide (PubChem CID 21177407) has the molecular formula C13H15Cl3NO4P and a molecular weight of 386.60 g/mol. Its IUPAC name is (Z)-3-phenyl-N-(2,2,2-trichloro-1-dimethoxyphosphorylethyl)prop-2-enamide.
| Compound Name | (Z)-3-phenyl-N-(2,2,2-trichloro-1-dimethoxyphosphorylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 21177407 |
| Molecular Formula | C13H15Cl3NO4P |
| Molecular Weight | 386.60 g/mol |
| Exact Mass | 384.98 |
| IUPAC Name | (Z)-3-phenyl-N-(2,2,2-trichloro-1-dimethoxyphosphorylethyl)prop-2-enamide |
| SMILES | COP(=O)(OC)C(NC(=O)/C=C\c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H15Cl3NO4P/c1-20-22(19,21-2)12(13(14,15)16)17-11(18)9-8-10-6-4-3-5-7-10/h3-9,12H,1-2H3,(H,17,18)/b9-8- |
| InChIKey | OFRPUAPRUQZYLY-HJWRWDBZSA-N |
| XLogP | 4.00 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.60 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|