C19H17Cl3N2O3 — CID 35580368
methyl 2-[[(1S)-2,2,2-trichloro-1-[[(E)-3-phenylprop-2-enoyl]amino]ethyl]amino]benzoate (PubChem CID 35580368) has the molecular formula C19H17Cl3N2O3 and a molecular weight of 427.72 g/mol. Its IUPAC name is methyl 2-[[(1S)-2,2,2-trichloro-1-[[(E)-3-phenylprop-2-enoyl]amino]ethyl]amino]benzoate.
| Compound Name | methyl 2-[[(1S)-2,2,2-trichloro-1-[[(E)-3-phenylprop-2-enoyl]amino]ethyl]amino]benzoate |
|---|---|
| PubChem CID | 35580368 |
| Molecular Formula | C19H17Cl3N2O3 |
| Molecular Weight | 427.72 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | methyl 2-[[(1S)-2,2,2-trichloro-1-[[(E)-3-phenylprop-2-enoyl]amino]ethyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1N[C@@H](NC(=O)/C=C/c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C19H17Cl3N2O3/c1-27-17(26)14-9-5-6-10-15(14)23-18(19(20,21)22)24-16(25)12-11-13-7-3-2-4-8-13/h2-12,18,23H,1H3,(H,24,25)/b12-11+/t18-/m0/s1 |
| InChIKey | MSIGKZUHSDIRJG-DXRVJIQQSA-N |
| XLogP | 4.41 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.72 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|