C15H13Cl3N2O3S — CID 1100414
methyl 2-[[(1R)-2,2,2-trichloro-1-(thiophene-2-carbonylamino)ethyl]amino]benzoate (PubChem CID 1100414) has the molecular formula C15H13Cl3N2O3S and a molecular weight of 407.71 g/mol. Its IUPAC name is methyl 2-[[(1R)-2,2,2-trichloro-1-(thiophene-2-carbonylamino)ethyl]amino]benzoate.
| Compound Name | methyl 2-[[(1R)-2,2,2-trichloro-1-(thiophene-2-carbonylamino)ethyl]amino]benzoate |
|---|---|
| PubChem CID | 1100414 |
| Molecular Formula | C15H13Cl3N2O3S |
| Molecular Weight | 407.71 g/mol |
| Exact Mass | 405.97 |
| IUPAC Name | methyl 2-[[(1R)-2,2,2-trichloro-1-(thiophene-2-carbonylamino)ethyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1N[C@H](NC(=O)c1cccs1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H13Cl3N2O3S/c1-23-13(22)9-5-2-3-6-10(9)19-14(15(16,17)18)20-12(21)11-7-4-8-24-11/h2-8,14,19H,1H3,(H,20,21)/t14-/m1/s1 |
| InChIKey | MMAWQGNRWQFDIZ-CQSZACIVSA-N |
| XLogP | 4.07 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.71 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|