C21H18N2O4S — CID 2237012
methyl 2-[[(2S)-2-phenyl-2-(thiophene-2-carbonylamino)acetyl]amino]benzoate (PubChem CID 2237012) has the molecular formula C21H18N2O4S and a molecular weight of 394.45 g/mol. Its IUPAC name is methyl 2-[[(2S)-2-phenyl-2-(thiophene-2-carbonylamino)acetyl]amino]benzoate.
| Compound Name | methyl 2-[[(2S)-2-phenyl-2-(thiophene-2-carbonylamino)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 2237012 |
| Molecular Formula | C21H18N2O4S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | methyl 2-[[(2S)-2-phenyl-2-(thiophene-2-carbonylamino)acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)[C@@H](NC(=O)c1cccs1)c1ccccc1 |
| InChI | InChI=1S/C21H18N2O4S/c1-27-21(26)15-10-5-6-11-16(15)22-20(25)18(14-8-3-2-4-9-14)23-19(24)17-12-7-13-28-17/h2-13,18H,1H3,(H,22,25)(H,23,24)/t18-/m0/s1 |
| InChIKey | NUBTUEGGRBRCAD-SFHVURJKSA-N |
| XLogP | 3.64 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |