C16H15N3O5S — CID 55538727
[1-(carbamoylamino)-1-oxopropan-2-yl] 2-(thiophene-2-carbonylamino)benzoate (PubChem CID 55538727) has the molecular formula C16H15N3O5S and a molecular weight of 361.38 g/mol. Its IUPAC name is [1-(carbamoylamino)-1-oxopropan-2-yl] 2-(thiophene-2-carbonylamino)benzoate.
| Compound Name | [1-(carbamoylamino)-1-oxopropan-2-yl] 2-(thiophene-2-carbonylamino)benzoate |
|---|---|
| PubChem CID | 55538727 |
| Molecular Formula | C16H15N3O5S |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | [1-(carbamoylamino)-1-oxopropan-2-yl] 2-(thiophene-2-carbonylamino)benzoate |
| SMILES | CC(OC(=O)c1ccccc1NC(=O)c1cccs1)C(=O)NC(N)=O |
| InChI | InChI=1S/C16H15N3O5S/c1-9(13(20)19-16(17)23)24-15(22)10-5-2-3-6-11(10)18-14(21)12-7-4-8-25-12/h2-9H,1H3,(H,18,21)(H3,17,19,20,23) |
| InChIKey | QQOAXBSSEJUJGO-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |