C18H16N2O2S2 — CID 25497398
N-[2-[[(1R)-1-thiophen-2-ylethyl]carbamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 25497398) has the molecular formula C18H16N2O2S2 and a molecular weight of 356.47 g/mol. Its IUPAC name is N-[2-[[(1R)-1-thiophen-2-ylethyl]carbamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[2-[[(1R)-1-thiophen-2-ylethyl]carbamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 25497398 |
| Molecular Formula | C18H16N2O2S2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | N-[2-[[(1R)-1-thiophen-2-ylethyl]carbamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | C[C@@H](NC(=O)c1ccccc1NC(=O)c1cccs1)c1cccs1 |
| InChI | InChI=1S/C18H16N2O2S2/c1-12(15-8-4-10-23-15)19-17(21)13-6-2-3-7-14(13)20-18(22)16-9-5-11-24-16/h2-12H,1H3,(H,19,21)(H,20,22)/t12-/m1/s1 |
| InChIKey | JUICIVBKKLBQFE-GFCCVEGCSA-N |
| XLogP | 4.55 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |