C17H18N2O4S — CID 39753213
methyl 2-[4-(thiophene-2-carbonylamino)butanoylamino]benzoate (PubChem CID 39753213) has the molecular formula C17H18N2O4S and a molecular weight of 346.41 g/mol. Its IUPAC name is methyl 2-[4-(thiophene-2-carbonylamino)butanoylamino]benzoate.
| Compound Name | methyl 2-[4-(thiophene-2-carbonylamino)butanoylamino]benzoate |
|---|---|
| PubChem CID | 39753213 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | methyl 2-[4-(thiophene-2-carbonylamino)butanoylamino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)CCCNC(=O)c1cccs1 |
| InChI | InChI=1S/C17H18N2O4S/c1-23-17(22)12-6-2-3-7-13(12)19-15(20)9-4-10-18-16(21)14-8-5-11-24-14/h2-3,5-8,11H,4,9-10H2,1H3,(H,18,21)(H,19,20) |
| InChIKey | QENYULZQIMRJCK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|