C28H38N4O6 — CID 17148582
N,N'-bis[2-(3-methoxypropylcarbamoyl)phenyl]hexanediamide (PubChem CID 17148582) has the molecular formula C28H38N4O6 and a molecular weight of 526.63 g/mol. Its IUPAC name is N,N'-bis[2-(3-methoxypropylcarbamoyl)phenyl]hexanediamide.
| Compound Name | N,N'-bis[2-(3-methoxypropylcarbamoyl)phenyl]hexanediamide |
|---|---|
| PubChem CID | 17148582 |
| Molecular Formula | C28H38N4O6 |
| Molecular Weight | 526.63 g/mol |
| Exact Mass | 526.28 |
| IUPAC Name | N,N'-bis[2-(3-methoxypropylcarbamoyl)phenyl]hexanediamide |
| SMILES | COCCCNC(=O)c1ccccc1NC(=O)CCCCC(=O)Nc1ccccc1C(=O)NCCCOC |
| InChI | InChI=1S/C28H38N4O6/c1-37-19-9-17-29-27(35)21-11-3-5-13-23(21)31-25(33)15-7-8-16-26(34)32-24-14-6-4-12-22(24)28(36)30-18-10-20-38-2/h3-6,11-14H,7-10,15-20H2,1-2H3,(H,29,35)(H,30,36)(H,31,33)(H,32,34) |
| InChIKey | SSTXKIIZGGUWAX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.63 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|