C15H20N2O4 — CID 28638069
methyl 3-[2-(butylcarbamoyl)anilino]-3-oxopropanoate (PubChem CID 28638069) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is methyl 3-[2-(butylcarbamoyl)anilino]-3-oxopropanoate.
| Compound Name | methyl 3-[2-(butylcarbamoyl)anilino]-3-oxopropanoate |
|---|---|
| PubChem CID | 28638069 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | methyl 3-[2-(butylcarbamoyl)anilino]-3-oxopropanoate |
| SMILES | CCCCNC(=O)c1ccccc1NC(=O)CC(=O)OC |
| InChI | InChI=1S/C15H20N2O4/c1-3-4-9-16-15(20)11-7-5-6-8-12(11)17-13(18)10-14(19)21-2/h5-8H,3-4,9-10H2,1-2H3,(H,16,20)(H,17,18) |
| InChIKey | AUQRRBPORZYDHU-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|