C14H18N2O4 — CID 28638001
methyl 3-oxo-3-[2-(propan-2-ylcarbamoyl)anilino]propanoate (PubChem CID 28638001) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is methyl 3-oxo-3-[2-(propan-2-ylcarbamoyl)anilino]propanoate.
| Compound Name | methyl 3-oxo-3-[2-(propan-2-ylcarbamoyl)anilino]propanoate |
|---|---|
| PubChem CID | 28638001 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | methyl 3-oxo-3-[2-(propan-2-ylcarbamoyl)anilino]propanoate |
| SMILES | COC(=O)CC(=O)Nc1ccccc1C(=O)NC(C)C |
| InChI | InChI=1S/C14H18N2O4/c1-9(2)15-14(19)10-6-4-5-7-11(10)16-12(17)8-13(18)20-3/h4-7,9H,8H2,1-3H3,(H,15,19)(H,16,17) |
| InChIKey | RYFKZEYTTAEIPY-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|