C18H25N3O5S — CID 17338904
2-methoxyethyl 4-oxo-4-[[2-(propan-2-ylcarbamoyl)phenyl]carbamothioylamino]butanoate (PubChem CID 17338904) has the molecular formula C18H25N3O5S and a molecular weight of 395.48 g/mol. Its IUPAC name is 2-methoxyethyl 4-oxo-4-[[2-(propan-2-ylcarbamoyl)phenyl]carbamothioylamino]butanoate.
| Compound Name | 2-methoxyethyl 4-oxo-4-[[2-(propan-2-ylcarbamoyl)phenyl]carbamothioylamino]butanoate |
|---|---|
| PubChem CID | 17338904 |
| Molecular Formula | C18H25N3O5S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 2-methoxyethyl 4-oxo-4-[[2-(propan-2-ylcarbamoyl)phenyl]carbamothioylamino]butanoate |
| SMILES | COCCOC(=O)CCC(=O)NC(=S)Nc1ccccc1C(=O)NC(C)C |
| InChI | InChI=1S/C18H25N3O5S/c1-12(2)19-17(24)13-6-4-5-7-14(13)20-18(27)21-15(22)8-9-16(23)26-11-10-25-3/h4-7,12H,8-11H2,1-3H3,(H,19,24)(H2,20,21,22,27) |
| InChIKey | MZYBLKVSMRJWCN-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|