C15H20N2O5S — CID 17338862
2-methoxyethyl 4-[(2-methoxyphenyl)carbamothioylamino]-4-oxobutanoate (PubChem CID 17338862) has the molecular formula C15H20N2O5S and a molecular weight of 340.40 g/mol. Its IUPAC name is 2-methoxyethyl 4-[(2-methoxyphenyl)carbamothioylamino]-4-oxobutanoate.
| Compound Name | 2-methoxyethyl 4-[(2-methoxyphenyl)carbamothioylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 17338862 |
| Molecular Formula | C15H20N2O5S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 2-methoxyethyl 4-[(2-methoxyphenyl)carbamothioylamino]-4-oxobutanoate |
| SMILES | COCCOC(=O)CCC(=O)NC(=S)Nc1ccccc1OC |
| InChI | InChI=1S/C15H20N2O5S/c1-20-9-10-22-14(19)8-7-13(18)17-15(23)16-11-5-3-4-6-12(11)21-2/h3-6H,7-10H2,1-2H3,(H2,16,17,18,23) |
| InChIKey | KUYMNEUYVGDNRC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|