C15H19BrN2O4S — CID 54784712
2-methoxyethyl 4-[(2-bromo-4-methylphenyl)carbamothioylamino]-4-oxobutanoate (PubChem CID 54784712) has the molecular formula C15H19BrN2O4S and a molecular weight of 403.30 g/mol. Its IUPAC name is 2-methoxyethyl 4-[(2-bromo-4-methylphenyl)carbamothioylamino]-4-oxobutanoate.
| Compound Name | 2-methoxyethyl 4-[(2-bromo-4-methylphenyl)carbamothioylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 54784712 |
| Molecular Formula | C15H19BrN2O4S |
| Molecular Weight | 403.30 g/mol |
| Exact Mass | 402.02 |
| IUPAC Name | 2-methoxyethyl 4-[(2-bromo-4-methylphenyl)carbamothioylamino]-4-oxobutanoate |
| SMILES | COCCOC(=O)CCC(=O)NC(=S)Nc1ccc(C)cc1Br |
| InChI | InChI=1S/C15H19BrN2O4S/c1-10-3-4-12(11(16)9-10)17-15(23)18-13(19)5-6-14(20)22-8-7-21-2/h3-4,9H,5-8H2,1-2H3,(H2,17,18,19,23) |
| InChIKey | WKYTWVCUPOCGAF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.30 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|