C14H19BrN2OS — CID 54784813
N-[(2-bromo-4-methylphenyl)carbamothioyl]hexanamide (PubChem CID 54784813) has the molecular formula C14H19BrN2OS and a molecular weight of 343.29 g/mol. Its IUPAC name is N-[(2-bromo-4-methylphenyl)carbamothioyl]hexanamide.
| Compound Name | N-[(2-bromo-4-methylphenyl)carbamothioyl]hexanamide |
|---|---|
| PubChem CID | 54784813 |
| Molecular Formula | C14H19BrN2OS |
| Molecular Weight | 343.29 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | N-[(2-bromo-4-methylphenyl)carbamothioyl]hexanamide |
| SMILES | CCCCCC(=O)NC(=S)Nc1ccc(C)cc1Br |
| InChI | InChI=1S/C14H19BrN2OS/c1-3-4-5-6-13(18)17-14(19)16-12-8-7-10(2)9-11(12)15/h7-9H,3-6H2,1-2H3,(H2,16,17,18,19) |
| InChIKey | OPPXZRMCMIJXIR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.29 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|