C18H25N3O4S — CID 46760847
propyl 4-[[2-methyl-3-(propanoylamino)phenyl]carbamothioylamino]-4-oxobutanoate (PubChem CID 46760847) has the molecular formula C18H25N3O4S and a molecular weight of 379.48 g/mol. Its IUPAC name is propyl 4-[[2-methyl-3-(propanoylamino)phenyl]carbamothioylamino]-4-oxobutanoate.
| Compound Name | propyl 4-[[2-methyl-3-(propanoylamino)phenyl]carbamothioylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 46760847 |
| Molecular Formula | C18H25N3O4S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | propyl 4-[[2-methyl-3-(propanoylamino)phenyl]carbamothioylamino]-4-oxobutanoate |
| SMILES | CCCOC(=O)CCC(=O)NC(=S)Nc1cccc(NC(=O)CC)c1C |
| InChI | InChI=1S/C18H25N3O4S/c1-4-11-25-17(24)10-9-16(23)21-18(26)20-14-8-6-7-13(12(14)3)19-15(22)5-2/h6-8H,4-5,9-11H2,1-3H3,(H,19,22)(H2,20,21,23,26) |
| InChIKey | JVAIWNOZEHWASI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|