C15H19N3O4S — CID 4933456
propyl 4-[(4-carbamoylphenyl)carbamothioylamino]-4-oxobutanoate (PubChem CID 4933456) has the molecular formula C15H19N3O4S and a molecular weight of 337.40 g/mol. Its IUPAC name is propyl 4-[(4-carbamoylphenyl)carbamothioylamino]-4-oxobutanoate.
| Compound Name | propyl 4-[(4-carbamoylphenyl)carbamothioylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 4933456 |
| Molecular Formula | C15H19N3O4S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | propyl 4-[(4-carbamoylphenyl)carbamothioylamino]-4-oxobutanoate |
| SMILES | CCCOC(=O)CCC(=O)NC(=S)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C15H19N3O4S/c1-2-9-22-13(20)8-7-12(19)18-15(23)17-11-5-3-10(4-6-11)14(16)21/h3-6H,2,7-9H2,1H3,(H2,16,21)(H2,17,18,19,23) |
| InChIKey | LRYUWDFVTZTWSR-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|