C20H29N3O4S — CID 17196510
ethyl 4-[[4-(dipropylcarbamoyl)phenyl]carbamothioylamino]-4-oxobutanoate (PubChem CID 17196510) has the molecular formula C20H29N3O4S and a molecular weight of 407.54 g/mol. Its IUPAC name is ethyl 4-[[4-(dipropylcarbamoyl)phenyl]carbamothioylamino]-4-oxobutanoate.
| Compound Name | ethyl 4-[[4-(dipropylcarbamoyl)phenyl]carbamothioylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 17196510 |
| Molecular Formula | C20H29N3O4S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | ethyl 4-[[4-(dipropylcarbamoyl)phenyl]carbamothioylamino]-4-oxobutanoate |
| SMILES | CCCN(CCC)C(=O)c1ccc(NC(=S)NC(=O)CCC(=O)OCC)cc1 |
| InChI | InChI=1S/C20H29N3O4S/c1-4-13-23(14-5-2)19(26)15-7-9-16(10-8-15)21-20(28)22-17(24)11-12-18(25)27-6-3/h7-10H,4-6,11-14H2,1-3H3,(H2,21,22,24,28) |
| InChIKey | QKWJZZQUHZCVTI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|