C17H23N3O5S — CID 17234537
2-methoxyethyl 4-[[4-(ethylcarbamoyl)phenyl]carbamothioylamino]-4-oxobutanoate (PubChem CID 17234537) has the molecular formula C17H23N3O5S and a molecular weight of 381.45 g/mol. Its IUPAC name is 2-methoxyethyl 4-[[4-(ethylcarbamoyl)phenyl]carbamothioylamino]-4-oxobutanoate.
| Compound Name | 2-methoxyethyl 4-[[4-(ethylcarbamoyl)phenyl]carbamothioylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 17234537 |
| Molecular Formula | C17H23N3O5S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 2-methoxyethyl 4-[[4-(ethylcarbamoyl)phenyl]carbamothioylamino]-4-oxobutanoate |
| SMILES | CCNC(=O)c1ccc(NC(=S)NC(=O)CCC(=O)OCCOC)cc1 |
| InChI | InChI=1S/C17H23N3O5S/c1-3-18-16(23)12-4-6-13(7-5-12)19-17(26)20-14(21)8-9-15(22)25-11-10-24-2/h4-7H,3,8-11H2,1-2H3,(H,18,23)(H2,19,20,21,26) |
| InChIKey | ODJWRCGQWUXEFQ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|