C23H27N3O4S — CID 17196582
methyl 3-[[4-(dipropylcarbamoyl)phenyl]carbamothioylcarbamoyl]benzoate (PubChem CID 17196582) has the molecular formula C23H27N3O4S and a molecular weight of 441.55 g/mol. Its IUPAC name is methyl 3-[[4-(dipropylcarbamoyl)phenyl]carbamothioylcarbamoyl]benzoate.
| Compound Name | methyl 3-[[4-(dipropylcarbamoyl)phenyl]carbamothioylcarbamoyl]benzoate |
|---|---|
| PubChem CID | 17196582 |
| Molecular Formula | C23H27N3O4S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | methyl 3-[[4-(dipropylcarbamoyl)phenyl]carbamothioylcarbamoyl]benzoate |
| SMILES | CCCN(CCC)C(=O)c1ccc(NC(=S)NC(=O)c2cccc(C(=O)OC)c2)cc1 |
| InChI | InChI=1S/C23H27N3O4S/c1-4-13-26(14-5-2)21(28)16-9-11-19(12-10-16)24-23(31)25-20(27)17-7-6-8-18(15-17)22(29)30-3/h6-12,15H,4-5,13-14H2,1-3H3,(H2,24,25,27,31) |
| InChIKey | YLPRJHCQHKLIQN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|