C25H33N3O3S — CID 26162655
3-[(3-butoxybenzoyl)carbamothioylamino]-N,N-dipropylbenzamide (PubChem CID 26162655) has the molecular formula C25H33N3O3S and a molecular weight of 455.62 g/mol. Its IUPAC name is 3-[(3-butoxybenzoyl)carbamothioylamino]-N,N-dipropylbenzamide.
| Compound Name | 3-[(3-butoxybenzoyl)carbamothioylamino]-N,N-dipropylbenzamide |
|---|---|
| PubChem CID | 26162655 |
| Molecular Formula | C25H33N3O3S |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | 3-[(3-butoxybenzoyl)carbamothioylamino]-N,N-dipropylbenzamide |
| SMILES | CCCCOc1cccc(C(=O)NC(=S)Nc2cccc(C(=O)N(CCC)CCC)c2)c1 |
| InChI | InChI=1S/C25H33N3O3S/c1-4-7-16-31-22-13-9-10-19(18-22)23(29)27-25(32)26-21-12-8-11-20(17-21)24(30)28(14-5-2)15-6-3/h8-13,17-18H,4-7,14-16H2,1-3H3,(H2,26,27,29,32) |
| InChIKey | POVLZDBALPYACJ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|