C20H19N3O3S — CID 4947179
2-phenylethyl 4-[(2-cyanophenyl)carbamothioylamino]-4-oxobutanoate (PubChem CID 4947179) has the molecular formula C20H19N3O3S and a molecular weight of 381.46 g/mol. Its IUPAC name is 2-phenylethyl 4-[(2-cyanophenyl)carbamothioylamino]-4-oxobutanoate.
| Compound Name | 2-phenylethyl 4-[(2-cyanophenyl)carbamothioylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 4947179 |
| Molecular Formula | C20H19N3O3S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 2-phenylethyl 4-[(2-cyanophenyl)carbamothioylamino]-4-oxobutanoate |
| SMILES | N#Cc1ccccc1NC(=S)NC(=O)CCC(=O)OCCc1ccccc1 |
| InChI | InChI=1S/C20H19N3O3S/c21-14-16-8-4-5-9-17(16)22-20(27)23-18(24)10-11-19(25)26-13-12-15-6-2-1-3-7-15/h1-9H,10-13H2,(H2,22,23,24,27) |
| InChIKey | YWUWSXRFIWQMQM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|