C16H20N2O4S — CID 17098272
ethyl 4-oxo-4-[(2-prop-2-enoxyphenyl)carbamothioylamino]butanoate (PubChem CID 17098272) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is ethyl 4-oxo-4-[(2-prop-2-enoxyphenyl)carbamothioylamino]butanoate.
| Compound Name | ethyl 4-oxo-4-[(2-prop-2-enoxyphenyl)carbamothioylamino]butanoate |
|---|---|
| PubChem CID | 17098272 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | ethyl 4-oxo-4-[(2-prop-2-enoxyphenyl)carbamothioylamino]butanoate |
| SMILES | C=CCOc1ccccc1NC(=S)NC(=O)CCC(=O)OCC |
| InChI | InChI=1S/C16H20N2O4S/c1-3-11-22-13-8-6-5-7-12(13)17-16(23)18-14(19)9-10-15(20)21-4-2/h3,5-8H,1,4,9-11H2,2H3,(H2,17,18,19,23) |
| InChIKey | JNUMXHCRJQIERP-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|