C17H21ClN4O5S — CID 4502836
ethyl 4-[[[4-(2-chloroanilino)-4-oxobutanoyl]amino]carbamothioylamino]-4-oxobutanoate (PubChem CID 4502836) has the molecular formula C17H21ClN4O5S and a molecular weight of 428.90 g/mol. Its IUPAC name is ethyl 4-[[[4-(2-chloroanilino)-4-oxobutanoyl]amino]carbamothioylamino]-4-oxobutanoate.
| Compound Name | ethyl 4-[[[4-(2-chloroanilino)-4-oxobutanoyl]amino]carbamothioylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 4502836 |
| Molecular Formula | C17H21ClN4O5S |
| Molecular Weight | 428.90 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | ethyl 4-[[[4-(2-chloroanilino)-4-oxobutanoyl]amino]carbamothioylamino]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)NC(=S)NNC(=O)CCC(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C17H21ClN4O5S/c1-2-27-16(26)10-9-14(24)20-17(28)22-21-15(25)8-7-13(23)19-12-6-4-3-5-11(12)18/h3-6H,2,7-10H2,1H3,(H,19,23)(H,21,25)(H2,20,22,24,28) |
| InChIKey | MUVCQANJMVMGGK-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.90 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|