C19H19ClN4O3S — CID 4505087
N-(2-chlorophenyl)-4-oxo-4-[2-[(2-phenylacetyl)carbamothioyl]hydrazinyl]butanamide (PubChem CID 4505087) has the molecular formula C19H19ClN4O3S and a molecular weight of 418.91 g/mol. Its IUPAC name is N-(2-chlorophenyl)-4-oxo-4-[2-[(2-phenylacetyl)carbamothioyl]hydrazinyl]butanamide.
| Compound Name | N-(2-chlorophenyl)-4-oxo-4-[2-[(2-phenylacetyl)carbamothioyl]hydrazinyl]butanamide |
|---|---|
| PubChem CID | 4505087 |
| Molecular Formula | C19H19ClN4O3S |
| Molecular Weight | 418.91 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | N-(2-chlorophenyl)-4-oxo-4-[2-[(2-phenylacetyl)carbamothioyl]hydrazinyl]butanamide |
| SMILES | O=C(CCC(=O)Nc1ccccc1Cl)NNC(=S)NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C19H19ClN4O3S/c20-14-8-4-5-9-15(14)21-16(25)10-11-17(26)23-24-19(28)22-18(27)12-13-6-2-1-3-7-13/h1-9H,10-12H2,(H,21,25)(H,23,26)(H2,22,24,27,28) |
| InChIKey | YLSMOZWTDFZMPK-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.91 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|