C17H18N4OS2 — CID 14221149
N-[(benzylcarbamothioylamino)carbamothioyl]-2-phenylacetamide (PubChem CID 14221149) has the molecular formula C17H18N4OS2 and a molecular weight of 358.49 g/mol. Its IUPAC name is N-[(benzylcarbamothioylamino)carbamothioyl]-2-phenylacetamide.
| Compound Name | N-[(benzylcarbamothioylamino)carbamothioyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 14221149 |
| Molecular Formula | C17H18N4OS2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | N-[(benzylcarbamothioylamino)carbamothioyl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)NC(=S)NNC(=S)NCc1ccccc1 |
| InChI | InChI=1S/C17H18N4OS2/c22-15(11-13-7-3-1-4-8-13)19-17(24)21-20-16(23)18-12-14-9-5-2-6-10-14/h1-10H,11-12H2,(H2,18,20,23)(H2,19,21,22,24) |
| InChIKey | GDFUYSIMBQPEPN-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|