C16H17N3S — CID 2143471
1-benzyl-3-(1-phenylethenylamino)thiourea (PubChem CID 2143471) has the molecular formula C16H17N3S and a molecular weight of 283.40 g/mol. Its IUPAC name is 1-benzyl-3-(1-phenylethenylamino)thiourea.
| Compound Name | 1-benzyl-3-(1-phenylethenylamino)thiourea |
|---|---|
| PubChem CID | 2143471 |
| Molecular Formula | C16H17N3S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 1-benzyl-3-(1-phenylethenylamino)thiourea |
| SMILES | C=C(NNC(=S)NCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H17N3S/c1-13(15-10-6-3-7-11-15)18-19-16(20)17-12-14-8-4-2-5-9-14/h2-11,18H,1,12H2,(H2,17,19,20) |
| InChIKey | IHJNSUUZFSTABH-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|