C17H17N3O2S — CID 2341739
1-[1-(1,3-benzodioxol-5-yl)ethenylamino]-3-benzylthiourea (PubChem CID 2341739) has the molecular formula C17H17N3O2S and a molecular weight of 327.41 g/mol. Its IUPAC name is 1-[1-(1,3-benzodioxol-5-yl)ethenylamino]-3-benzylthiourea.
| Compound Name | 1-[1-(1,3-benzodioxol-5-yl)ethenylamino]-3-benzylthiourea |
|---|---|
| PubChem CID | 2341739 |
| Molecular Formula | C17H17N3O2S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 1-[1-(1,3-benzodioxol-5-yl)ethenylamino]-3-benzylthiourea |
| SMILES | C=C(NNC(=S)NCc1ccccc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H17N3O2S/c1-12(14-7-8-15-16(9-14)22-11-21-15)19-20-17(23)18-10-13-5-3-2-4-6-13/h2-9,19H,1,10-11H2,(H2,18,20,23) |
| InChIKey | JPTUZHGHYKEKTP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 54.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|