C24H23N3O4S — CID 24637371
1-(1,3-benzodioxol-5-ylmethyl)-3-[[2-(2-benzylphenoxy)acetyl]amino]thiourea (PubChem CID 24637371) has the molecular formula C24H23N3O4S and a molecular weight of 449.53 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[[2-(2-benzylphenoxy)acetyl]amino]thiourea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[[2-(2-benzylphenoxy)acetyl]amino]thiourea |
|---|---|
| PubChem CID | 24637371 |
| Molecular Formula | C24H23N3O4S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[[2-(2-benzylphenoxy)acetyl]amino]thiourea |
| SMILES | O=C(COc1ccccc1Cc1ccccc1)NNC(=S)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H23N3O4S/c28-23(15-29-20-9-5-4-8-19(20)12-17-6-2-1-3-7-17)26-27-24(32)25-14-18-10-11-21-22(13-18)31-16-30-21/h1-11,13H,12,14-16H2,(H,26,28)(H2,25,27,32) |
| InChIKey | YGDGNFYLBIGFPY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|