C25H24N2O5 — CID 25470974
N'-[2-(2-benzylphenoxy)acetyl]-3,4-dihydro-2H-1,5-benzodioxepine-7-carbohydrazide (PubChem CID 25470974) has the molecular formula C25H24N2O5 and a molecular weight of 432.48 g/mol. Its IUPAC name is N'-[2-(2-benzylphenoxy)acetyl]-3,4-dihydro-2H-1,5-benzodioxepine-7-carbohydrazide.
| Compound Name | N'-[2-(2-benzylphenoxy)acetyl]-3,4-dihydro-2H-1,5-benzodioxepine-7-carbohydrazide |
|---|---|
| PubChem CID | 25470974 |
| Molecular Formula | C25H24N2O5 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | N'-[2-(2-benzylphenoxy)acetyl]-3,4-dihydro-2H-1,5-benzodioxepine-7-carbohydrazide |
| SMILES | O=C(COc1ccccc1Cc1ccccc1)NNC(=O)c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C25H24N2O5/c28-24(17-32-21-10-5-4-9-19(21)15-18-7-2-1-3-8-18)26-27-25(29)20-11-12-22-23(16-20)31-14-6-13-30-22/h1-5,7-12,16H,6,13-15,17H2,(H,26,28)(H,27,29) |
| InChIKey | MKRAQSXSWKITFG-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|