C27H30N4O5S — CID 4830331
N'-[2-(2-benzylphenoxy)acetyl]-3-(4-methylpiperazin-1-yl)sulfonylbenzohydrazide (PubChem CID 4830331) has the molecular formula C27H30N4O5S and a molecular weight of 522.63 g/mol. Its IUPAC name is N'-[2-(2-benzylphenoxy)acetyl]-3-(4-methylpiperazin-1-yl)sulfonylbenzohydrazide.
| Compound Name | N'-[2-(2-benzylphenoxy)acetyl]-3-(4-methylpiperazin-1-yl)sulfonylbenzohydrazide |
|---|---|
| PubChem CID | 4830331 |
| Molecular Formula | C27H30N4O5S |
| Molecular Weight | 522.63 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | N'-[2-(2-benzylphenoxy)acetyl]-3-(4-methylpiperazin-1-yl)sulfonylbenzohydrazide |
| SMILES | CN1CCN(S(=O)(=O)c2cccc(C(=O)NNC(=O)COc3ccccc3Cc3ccccc3)c2)CC1 |
| InChI | InChI=1S/C27H30N4O5S/c1-30-14-16-31(17-15-30)37(34,35)24-12-7-11-23(19-24)27(33)29-28-26(32)20-36-25-13-6-5-10-22(25)18-21-8-3-2-4-9-21/h2-13,19H,14-18,20H2,1H3,(H,28,32)(H,29,33) |
| InChIKey | ZEBKKMSOFWLJJA-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.63 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|