C22H28N4O4S — CID 31288599
N-[2-(2-ethylanilino)-2-oxoethyl]-3-(4-methylpiperazin-1-yl)sulfonylbenzamide (PubChem CID 31288599) has the molecular formula C22H28N4O4S and a molecular weight of 444.56 g/mol. Its IUPAC name is N-[2-(2-ethylanilino)-2-oxoethyl]-3-(4-methylpiperazin-1-yl)sulfonylbenzamide.
| Compound Name | N-[2-(2-ethylanilino)-2-oxoethyl]-3-(4-methylpiperazin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 31288599 |
| Molecular Formula | C22H28N4O4S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | N-[2-(2-ethylanilino)-2-oxoethyl]-3-(4-methylpiperazin-1-yl)sulfonylbenzamide |
| SMILES | CCc1ccccc1NC(=O)CNC(=O)c1cccc(S(=O)(=O)N2CCN(C)CC2)c1 |
| InChI | InChI=1S/C22H28N4O4S/c1-3-17-7-4-5-10-20(17)24-21(27)16-23-22(28)18-8-6-9-19(15-18)31(29,30)26-13-11-25(2)12-14-26/h4-10,15H,3,11-14,16H2,1-2H3,(H,23,28)(H,24,27) |
| InChIKey | UKMGSTAOYXVUEA-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |