C24H21ClN2O5 — CID 26259289
6-chloro-N'-[2-(2-phenylphenoxy)acetyl]-3,4-dihydro-2H-1,5-benzodioxepine-8-carbohydrazide (PubChem CID 26259289) has the molecular formula C24H21ClN2O5 and a molecular weight of 452.89 g/mol. Its IUPAC name is 6-chloro-N'-[2-(2-phenylphenoxy)acetyl]-3,4-dihydro-2H-1,5-benzodioxepine-8-carbohydrazide.
| Compound Name | 6-chloro-N'-[2-(2-phenylphenoxy)acetyl]-3,4-dihydro-2H-1,5-benzodioxepine-8-carbohydrazide |
|---|---|
| PubChem CID | 26259289 |
| Molecular Formula | C24H21ClN2O5 |
| Molecular Weight | 452.89 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | 6-chloro-N'-[2-(2-phenylphenoxy)acetyl]-3,4-dihydro-2H-1,5-benzodioxepine-8-carbohydrazide |
| SMILES | O=C(COc1ccccc1-c1ccccc1)NNC(=O)c1cc(Cl)c2c(c1)OCCCO2 |
| InChI | InChI=1S/C24H21ClN2O5/c25-19-13-17(14-21-23(19)31-12-6-11-30-21)24(29)27-26-22(28)15-32-20-10-5-4-9-18(20)16-7-2-1-3-8-16/h1-5,7-10,13-14H,6,11-12,15H2,(H,26,28)(H,27,29) |
| InChIKey | BALIIFWMSULLFM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.89 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|