C16H12ClFN2O5 — CID 9428453
7-chloro-N'-[2-(4-fluorophenoxy)acetyl]-1,3-benzodioxole-5-carbohydrazide (PubChem CID 9428453) has the molecular formula C16H12ClFN2O5 and a molecular weight of 366.73 g/mol. Its IUPAC name is 7-chloro-N'-[2-(4-fluorophenoxy)acetyl]-1,3-benzodioxole-5-carbohydrazide.
| Compound Name | 7-chloro-N'-[2-(4-fluorophenoxy)acetyl]-1,3-benzodioxole-5-carbohydrazide |
|---|---|
| PubChem CID | 9428453 |
| Molecular Formula | C16H12ClFN2O5 |
| Molecular Weight | 366.73 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | 7-chloro-N'-[2-(4-fluorophenoxy)acetyl]-1,3-benzodioxole-5-carbohydrazide |
| SMILES | O=C(COc1ccc(F)cc1)NNC(=O)c1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C16H12ClFN2O5/c17-12-5-9(6-13-15(12)25-8-24-13)16(22)20-19-14(21)7-23-11-3-1-10(18)2-4-11/h1-6H,7-8H2,(H,19,21)(H,20,22) |
| InChIKey | WICKWVKNXOIAFW-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.73 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|