C22H21N3S — CID 2356018
1-benzyl-3-[1-(4-phenylphenyl)ethenylamino]thiourea (PubChem CID 2356018) has the molecular formula C22H21N3S and a molecular weight of 359.50 g/mol. Its IUPAC name is 1-benzyl-3-[1-(4-phenylphenyl)ethenylamino]thiourea.
| Compound Name | 1-benzyl-3-[1-(4-phenylphenyl)ethenylamino]thiourea |
|---|---|
| PubChem CID | 2356018 |
| Molecular Formula | C22H21N3S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 1-benzyl-3-[1-(4-phenylphenyl)ethenylamino]thiourea |
| SMILES | C=C(NNC(=S)NCc1ccccc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H21N3S/c1-17(24-25-22(26)23-16-18-8-4-2-5-9-18)19-12-14-21(15-13-19)20-10-6-3-7-11-20/h2-15,24H,1,16H2,(H2,23,25,26) |
| InChIKey | BTPBTTYOWZGBCO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|