C17H20N4S3 — CID 9093461
1-benzyl-3-(2-phenylsulfanylethylcarbamothioylamino)thiourea (PubChem CID 9093461) has the molecular formula C17H20N4S3 and a molecular weight of 376.58 g/mol. Its IUPAC name is 1-benzyl-3-(2-phenylsulfanylethylcarbamothioylamino)thiourea.
| Compound Name | 1-benzyl-3-(2-phenylsulfanylethylcarbamothioylamino)thiourea |
|---|---|
| PubChem CID | 9093461 |
| Molecular Formula | C17H20N4S3 |
| Molecular Weight | 376.58 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 1-benzyl-3-(2-phenylsulfanylethylcarbamothioylamino)thiourea |
| SMILES | S=C(NCCSc1ccccc1)NNC(=S)NCc1ccccc1 |
| InChI | InChI=1S/C17H20N4S3/c22-16(18-11-12-24-15-9-5-2-6-10-15)20-21-17(23)19-13-14-7-3-1-4-8-14/h1-10H,11-13H2,(H2,18,20,22)(H2,19,21,23) |
| InChIKey | YNSHLWSSKDVRPG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.58 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|