C16H16N4O3S2 — CID 22831033
1-benzyl-3-[[2-(4-nitrophenyl)sulfanylacetyl]amino]thiourea (PubChem CID 22831033) has the molecular formula C16H16N4O3S2 and a molecular weight of 376.46 g/mol. Its IUPAC name is 1-benzyl-3-[[2-(4-nitrophenyl)sulfanylacetyl]amino]thiourea.
| Compound Name | 1-benzyl-3-[[2-(4-nitrophenyl)sulfanylacetyl]amino]thiourea |
|---|---|
| PubChem CID | 22831033 |
| Molecular Formula | C16H16N4O3S2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 1-benzyl-3-[[2-(4-nitrophenyl)sulfanylacetyl]amino]thiourea |
| SMILES | O=C(CSc1ccc([N+](=O)[O-])cc1)NNC(=S)NCc1ccccc1 |
| InChI | InChI=1S/C16H16N4O3S2/c21-15(11-25-14-8-6-13(7-9-14)20(22)23)18-19-16(24)17-10-12-4-2-1-3-5-12/h1-9H,10-11H2,(H,18,21)(H2,17,19,24) |
| InChIKey | DBRUCWYFZIAZJR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|