C13H18N4O3S2 — CID 9425614
1-tert-butyl-3-[[2-(4-nitrophenyl)sulfanylacetyl]amino]thiourea (PubChem CID 9425614) has the molecular formula C13H18N4O3S2 and a molecular weight of 342.45 g/mol. Its IUPAC name is 1-tert-butyl-3-[[2-(4-nitrophenyl)sulfanylacetyl]amino]thiourea.
| Compound Name | 1-tert-butyl-3-[[2-(4-nitrophenyl)sulfanylacetyl]amino]thiourea |
|---|---|
| PubChem CID | 9425614 |
| Molecular Formula | C13H18N4O3S2 |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 1-tert-butyl-3-[[2-(4-nitrophenyl)sulfanylacetyl]amino]thiourea |
| SMILES | CC(C)(C)NC(=S)NNC(=O)CSc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H18N4O3S2/c1-13(2,3)14-12(21)16-15-11(18)8-22-10-6-4-9(5-7-10)17(19)20/h4-7H,8H2,1-3H3,(H,15,18)(H2,14,16,21) |
| InChIKey | OSUUHHCIUHIXKB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|